Chiral, Three-Dimensional Supramolecular Compounds:  Homo- and Bimetallic Oxalate- and 1,2-Dithiooxalate-Bridged Networks. A Structural and Photophysical Study

In analogy to the M(II)(bpy)(3)(2+) cations, where M(II) is a divalent transition-metal and bpy is 2,2'-bipyridine, the tris-chelated M(III)(bpy)(3)(3+) cations, where M(III) is Cr(III) or Co(III), induce the crystallization of chiral, anionic three-dimensional (3D) coordination polymers of oxalate-bridged (-ox) metal complexes with stoichiometries M(II)(2)(ox)(3)(n)()(2)(n)()(-) or M(I)M(III)(ox)(3)(n)()(2)(n)()(-). The tripositive charge is partially compensated by inclusion of additional complex anions like ClO(4)(-), BF(4)(-), or PF(6)(-) which are encapsulated in cubic shaped cavities formed by the bipyridine ligands of the cations. Thus, an elaborate structure of cationic and anionic species within a polymeric anionic network is realized. The compounds isolated and structurally characterized include Cr(III)(bpy)(3)ClO(4) NaCr(III)(ox)(3) (1), Cr(III)(bpy)(3)ClO(4)Mn(II)(2)(ox)(3) (2), Cr(III)(bpy)(3)BF(4) Mn(II)(2)(ox)(3) (3), Co(III)(bpy)(3)PF(6)NaCr(III)(ox)(3) (4). Crystal data: 1, cubic, P2(1)3, a = 15.523(4) Å, Z = 4; 2, cubic, P4(1)32, a = 15.564(3) Å, Z = 4; 3, cubic, P4(1)32, a = 15.553(3) Å, Z = 4; 4, cubic, P2(1)3, a = 15.515(3) Å, Z = 4. Furthermore, it seemed likely that 1,2-dithiooxalate (dto) could act as an alternative to the oxalate bridging ligand, and as a result the compound Ni(II)(phen)(3)NaCo(III)(dto)(3).C(3)H(6)O (5) has successfully been isolated and structurally characterized. Crystal data: 5, orthorhombic, P2(1)2(1)2(1), a = 16.238(4) Å, b = 16.225(4) Å, c = 18.371(5) Å, Z = 4. In addition, the photophysical properties of compound 1 have been investigated in detail. In single crystal absorption spectra of Cr(III)(bpy)(3)ClO(4)NaCr(III)(ox)(3) (1), the spin-flip transitions of both the Cr(bpy)(3)(3+) and the Cr(ox)(3)(3)(-) chromophores are observed and can be clearly distinguished. Irradiating into the spin-allowed (4)A(2) --> (4)T(2) absorption band of Cr(ox)(3)(3)(-) results in intense luminescence from the (2)E state of Cr(bpy)(3)(3+) as a result of rapid energy transfer processes.