Two New Closely Related MoV Hydroxymonophosphates Built Up of Cd[Mo6P4O25(OH)6]2 And Cd[Mo6P4O26(OH)5]2 Clusters

Two new molybdenum(v) hydroxyphosphates have been synthesized hydrothermally, Na2Cd3(Mo2O4OH)6‐(PO4)2(PO3OH)6[N(CH3)4]4·10H20 (1) and Cd9(Mo2O4OH)12(PO4)6(PO3OH)10‐[N(CH3)4]8·15H2O (2). Their structures have been determined from single‐crystal X‐ray diffraction. The water molecules and hydroxyl groups have been deduced from valence calculations. Both compounds crystallize in the triclinic space group P1, with the cell parameters for 1 a = 12.340(2), b = 12.596(1), c = 14.717(2) Å, α = 107.24(1)°, β = 89.83(1)°, γ = 114.31(1)°, V = 1972.3(4) Å3, and for 2 a = 11.942(1), b = 13.339(2), c = 26.765(3) Å, α = 85.33(1)°, β = 86.87(1)°, γ = 64.08(1)°, V = 3821.3(9) Å3. The two frameworks can be described on the basis of similar [Mo6P4X31]n‐ (X = O, OH) anionic clusters, but 1 is a tridimensional structure, whereas 2 exhibits a monodimensional structure.